CAS 153-94-6: D-(+)-Tryptophan
Description:D-(+)-Tryptophan is an essential amino acid that plays a crucial role in protein synthesis and serves as a precursor for several important biomolecules, including serotonin, melatonin, and niacin. It is classified as a non-polar, aromatic amino acid due to its indole side chain, which contributes to its hydrophobic characteristics. D-(+)-Tryptophan is typically found in various dietary sources, including meat, dairy products, and certain seeds. The substance is known for its role in mood regulation and sleep patterns, as it is involved in the production of serotonin, a neurotransmitter that influences mood and behavior. In terms of physical properties, D-(+)-Tryptophan is a white crystalline powder that is soluble in water and slightly soluble in alcohol. It has a melting point that varies depending on the specific form and purity. As a chiral molecule, it exists in two enantiomeric forms, with D-(+)-Tryptophan being the biologically active form. Its CAS number, 153-94-6, is used for identification in chemical databases and regulatory contexts.
Formula:C11H12N2O2
InChI:InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m1/s1
InChI key:InChIKey=QIVBCDIJIAJPQS-SECBINFHSA-N
SMILES:O=C(O)C(N)CC1=CNC=2C=CC=CC21
- Synonyms:
- (+)-Tryptophan
- (2R)-2-Amino-3-(1H-indol-3-yl)propanoic acid
- (2R)-2-Azaniumyl-3-(1H-indol-3-yl)propanoate
- (R)-2-Amino-3-(3-indolyl)propionic acid
- (R)-Tryptophan
- (R)-α-Amino-3-indolepropionic acid
- (R)-α-Aminoindole-3-propanoic acid
- 3-(2,3-dihydro-1H-indol-3-yl)-D-alanine
- <span class="text-smallcaps">D</span>-Tryptophan
- <span class="text-smallcaps">D</span>-Tryptophane
- See more synonyms
- D-(+)-Tryptophane
- D-(+)-triptofano
- H-D-Trp-OH
- Nsc 97942
- Tryptophan, <span class="text-smallcaps">D</span>-
- Tryptophan, D-
- D-Tryptophan
