CAS 153-98-0: Serotonin hydrochloride
Description:Serotonin hydrochloride, with the CAS number 153-98-0, is a chemical compound that serves as the hydrochloride salt of serotonin, a neurotransmitter that plays a crucial role in regulating mood, appetite, and sleep. This compound is typically a white to off-white crystalline powder, highly soluble in water, which facilitates its use in various biological and pharmacological applications. Serotonin itself is derived from the amino acid tryptophan and is involved in numerous physiological processes, including the modulation of mood and anxiety. The hydrochloride form enhances its stability and solubility, making it suitable for research and potential therapeutic uses. In laboratory settings, serotonin hydrochloride is often utilized in studies related to neurobiology and pharmacology, particularly in understanding the mechanisms of mood disorders and the effects of antidepressants. However, due to its biological activity, handling and usage require caution, as it can influence various physiological responses in living organisms.
Formula:C10H12N2O·ClH
InChI:InChI=1S/C10H12N2O.ClH/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;/h1-2,5-6,12-13H,3-4,11H2;1H
InChI key:InChIKey=MDIGAZPGKJFIAH-UHFFFAOYSA-N
SMILES:Cl.OC=1C=CC=2NC=C(C2C1)CCN
- Synonyms:
- 1H-Indol-5-ol, 3-(2-aminoethyl)-, hydrochloride (1:1)
- 1H-Indol-5-ol, 3-(2-aminoethyl)-, monohydrochloride
- 3-(2-Aminoethyl)-5-hydroxyindole hydrochloride
- 3-(2-aminoethyl)-1H-indol-5-ol hydrochloride (1:1)
- 5-HT•HCl
- 5-Ht
- 5-Hydroxy-3-(2-Aminoethyl)INDOLE hydrochloride
- 5-Hydroxytryptamine HCL
- 5-Hydroxytryptamine hydrochloride
- Hippophaine hydrochloride
- See more synonyms
- Indol-5-ol, 3-(2-aminoethyl)-, monohydrochloride
- Seratonin hydrochloride
- Serotbonin Hydrochloride
- Serotonin HCL
- Timtec-Bb Sbb003418
- Serotonin hydrochloride
