CAS 153034-94-7

2-fluoro-4-iodo-5-methylpyridine

Description:

2-Fluoro-4-iodo-5-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a fluorine atom at the 2-position, an iodine atom at the 4-position, and a methyl group at the 5-position. This compound is part of the pyridine family, which is known for its aromatic properties and basicity due to the nitrogen atom in the ring. The presence of halogen substituents, specifically fluorine and iodine, can significantly influence the compound's reactivity, polarity, and potential applications in organic synthesis and medicinal chemistry. The methyl group contributes to the overall hydrophobic character of the molecule. 2-Fluoro-4-iodo-5-methylpyridine may exhibit interesting biological activities and can serve as a building block in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Its unique combination of functional groups allows for diverse reactivity patterns, making it a valuable compound in research and development within the field of organic chemistry.

Formula: C₆H₅FIN

InChI: InChI=1/C6H5FIN/c1-4-3-9-6(7)2-5(4)8/h2-3H,1H3

SMILES: Cc1cnc(cc1I)F

Synonyms:

• 2-Fluoro-4-Iodo-5-Picoline

2-Fluoro-4-iodo-5-methylpyridine

CAS: 153034-94-7

Formula: C₆H₅FIN

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 237.02

Ref: 3B-F1035

2-Fluoro-4-iodo-5-picoline

CAS: 153034-94-7

Formula: C₆H₅FIN

Purity: 96%

Color and Shape: Solid

Molecular weight: 237.0135

Ref: IN-DA003H9E

2-Fluoro-4-iodo-5-methylpyridine

CAS: 153034-94-7

2-Fluoro-4-iodo-5-methylpyridine

Purity: 98%

Color and Shape: Solid

Molecular weight: 237.01g/mol

Ref: 54-PC48305

2-Fluoro-4-iodo-5-methylpyridine

CAS: 153034-94-7

Ref: 7W-GK9565

2-Fluoro-4-iodo-5-methylpyridine

CAS: 153034-94-7

Purity: 98%

Molecular weight: 237.014

Ref: FT-Y14223

2-Fluoro-4-iodo-5-methylpyridine

CAS: 153034-94-7

Formula: C₆H₅FIN

Purity: 96%

Color and Shape: Solid

Molecular weight: 237.016

Ref: 10-F036281

2-Fluoro-4-iodo-5-methylpyridine

CAS: 153034-94-7

2-Fluoro-4-iodo-5-methylpyridine is a versatile building block that can be used as a reagent or reaction component. It is an intermediate for the production of pharmaceuticals, pesticides, and other organic compounds. 2-Fluoro-4-iodo-5-methylpyridine is also used as a speciality chemical in research laboratories. 2-Fluoro-4-iodo-5-methylpyridine can be used as a building block to produce complex compounds with various functionalities.

Formula: C₆H₅FIN

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 237.01 g/mol

Ref: 3D-FF06959