CymitQuimica logo

CAS 153037-40-2

:

Carbamic acid, [(1S)-2-[1,1'-biphenyl]-4-yl-1-(hydroxymethyl)ethyl]-,1,1-dimethylethyl ester

Description:
Carbamic acid, [(1S)-2-[1,1'-biphenyl]-4-yl-1-(hydroxymethyl)ethyl]-, 1,1-dimethylethyl ester, identified by CAS number 153037-40-2, is an organic compound characterized by its carbamate functional group. This compound features a biphenyl moiety, which contributes to its aromatic properties, and a hydroxymethyl group that enhances its reactivity and solubility in polar solvents. The presence of the tert-butyl ester group provides steric hindrance, which can influence its biological activity and stability. Typically, carbamic acid derivatives exhibit moderate to high lipophilicity due to their hydrophobic aromatic components, which can affect their interaction with biological membranes. Additionally, such compounds may demonstrate potential as intermediates in organic synthesis or as active pharmaceutical ingredients, depending on their specific functional groups and structural characteristics. The stereochemistry indicated by the (1S) configuration suggests that the compound may exhibit specific spatial arrangements that could influence its reactivity and interactions in biological systems. Overall, this compound's unique structure positions it as a candidate for various applications in medicinal chemistry and materials science.
Formula:C20H25NO3
InChI:InChI=1S/C20H25NO3/c1-20(2,3)24-19(23)21-18(14-22)13-15-9-11-17(12-10-15)16-7-5-4-6-8-16/h4-12,18,22H,13-14H2,1-3H3,(H,21,23)/t18-/m0/s1
InChI key:TYQICOFAZDVKMK-SFHVURJKSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)CO
Found 6 products.