CAS 15304-57-1
:Tin (II) phthalocyanine
Description:
Tin (II) phthalocyanine, with the CAS number 15304-57-1, is a coordination compound characterized by its deep blue-green color and its structure, which consists of a tin ion coordinated to a phthalocyanine ligand. This compound exhibits notable stability and is insoluble in water but can dissolve in organic solvents such as chloroform and dichloromethane. Tin (II) phthalocyanine is known for its strong light-absorbing properties, making it useful in various applications, including dyes, pigments, and as a photosensitizer in photodynamic therapy. Its electronic structure allows it to participate in redox reactions, which is beneficial in catalysis and electronic devices. Additionally, it has potential applications in organic solar cells and as a semiconductor material due to its ability to facilitate charge transfer. The compound's stability and unique optical properties make it a subject of interest in materials science and nanotechnology.
Formula:C32H16N8Sn
InChI:InChI=1/C32H16N8.Sn/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;/h1-16H;/q-2;+2/rC32H16N8Sn/c1-2-10-18-17(9-1)25-33-26(18)36-30-23-15-7-8-16-24(23)32-38-28-20-12-4-3-11-19(20)27(34-28)37-31-22-14-6-5-13-21(22)29(35-25)39(31)41-40(30)32/h1-16H/b35-25-,35-29-,36-26-,36-30-,37-27-,37-31-,38-28-,38-32-
SMILES:c1ccc2c(c1)C1=NC2=NC2=NC(=Nc3c4ccccc4c([n-]3)N=C3c4ccccc4C(=N3)[N-]1)c1ccccc21.[Sn]
Synonyms:- Phthalocyanatotin(II)
- Lt-S9086
- SnPC
- Tin(II)Phthalocyanine
- Tin(II) phthalocyanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Tin(II) Phthalocyanine
CAS:Formula:C32H16N8SnColor and Shape:Gray to Dark purple to Black powder to crystalMolecular weight:631.25Tin(II) phthalocyanine
CAS:<p>Tin(II) phthalocyanine</p>Formula:(C32H16N8)SnColor and Shape:purple pwdr.Molecular weight:631.24Tin(II) phthalocyanine
CAS:Formula:C32H16N8SnPurity:95%Color and Shape:SolidMolecular weight:631.2240Tin(II) phthalocyanine
CAS:<p>Tin(II) phthalocyanine is used as an organic light-emitting diode (OLED) material. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item co</p>





