CAS 1531-38-0
:1-phenyl-2-(quinolin-2-yl)ethanone
Description:
1-Phenyl-2-(quinolin-2-yl)ethanone, with the CAS number 1531-38-0, is an organic compound characterized by its ketone functional group and the presence of both phenyl and quinoline moieties. This compound typically appears as a solid or crystalline substance, exhibiting a distinct aromatic character due to the phenyl and quinoline rings. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the quinoline structure may impart biological activity, making it a subject of interest in drug discovery. The compound's solubility can vary depending on the solvent, and it may exhibit specific reactivity patterns typical of ketones, such as undergoing nucleophilic addition reactions. Additionally, its molecular structure suggests potential for interactions with biological targets, which can be explored in various research contexts. Overall, 1-phenyl-2-(quinolin-2-yl)ethanone is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C17H13NO
InChI:InChI=1/C17H13NO/c19-17(14-7-2-1-3-8-14)12-15-11-10-13-6-4-5-9-16(13)18-15/h1-11H,12H2
Synonyms:- ethanone, 1-phenyl-2-(2-quinolinyl)-
- 1-Phenyl-2-(quinolin-2-yl)ethanone
- 1-phenyl-2-(quinolin-2-yl)ethan-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Phenyl-2-(quinolin-2-yl)ethan-1-one
CAS:1-Phenyl-2-(quinolin-2-yl)ethan-1-one is an enolate that has the ability to form a zwitterion. It is soluble in nonpolar solvents and reacts with calcium carbonate, forming a white precipitate. This compound is reactive and can be used as an intermediate for the synthesis of many other organic compounds. 1-Phenyl-2-(quinolin-2-yl)ethan-1-one has been shown to interact with methyl derivatives and piperidine. The enolate anion can be activated by radiation or by adding a base such as piperidine.Formula:C17H13NOPurity:Min. 95%Molecular weight:247.29 g/mol
