CAS 1531-85-7
:11-[3-(Dimethylamino)propyl]-6,11-dihydrodibenzo[b,e]thiepin-11-ol
Description:
11-[3-(Dimethylamino)propyl]-6,11-dihydrodibenzo[b,e]thiepin-11-ol, commonly referred to by its CAS number 1531-85-7, is a chemical compound that belongs to the class of dibenzothiepin derivatives. This substance is characterized by its complex polycyclic structure, which includes a thiepin ring fused with two benzene rings. The presence of a hydroxyl group (-OH) at the 11-position contributes to its potential as a pharmacologically active agent. The dimethylamino group at the 3-position enhances its basicity and may influence its interaction with biological targets, particularly in the context of neurotransmitter systems. This compound has been studied for its potential therapeutic applications, particularly in the field of psychiatry, due to its structural similarity to various antipsychotic and antidepressant agents. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical entities. As with many organic compounds, safety and handling precautions are essential due to potential toxicity and reactivity.
Formula:C19H23NOS
InChI:InChI=1S/C19H23NOS/c1-20(2)13-7-12-19(21)16-9-4-3-8-15(16)14-22-18-11-6-5-10-17(18)19/h3-6,8-11,21H,7,12-14H2,1-2H3
InChI key:InChIKey=GIGQDDWBWCUOFZ-UHFFFAOYSA-N
SMILES:C(CCN(C)C)C1(O)C=2C(CSC=3C1=CC=CC3)=CC=CC2
Synonyms:- Dibenzo[b,e]thiepin-11-ol, 11-[3-(dimethylamino)propyl]-6,11-dihydro-
- 11-[3-(Dimethylamino)propyl]-6H-benzo[c][1]benzothiepin-11-ol
- 11-[3-(Dimethylamino)propyl]-6,11-dihydrodibenzo[b,e]thiepin-11-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
6,11-Dihydro-11-hydroxy Dothiepin
CAS:Controlled ProductApplications Dothiepin intermediate.
Formula:C19H23NOSColor and Shape:NeatMolecular weight:313.46


