CAS 153125-17-8
:2,2'-{[3,5-bis(decyloxy)phenyl]imino}diacetic acid
Description:
2,2'-{[3,5-bis(decyloxy)phenyl]imino}diacetic acid, with CAS number 153125-17-8, is a chemical compound characterized by its unique structure that includes an imino group and two acetic acid functionalities. This compound features a central diacetic acid moiety linked to a phenyl group that is further substituted with two decyloxy chains, enhancing its hydrophobic properties. The presence of the long alkyl chains contributes to its solubility in organic solvents and may influence its behavior in biological systems. The imino linkage introduces potential for hydrogen bonding and coordination with metal ions, making it of interest in coordination chemistry and materials science. Additionally, the compound may exhibit interesting thermal and optical properties due to its aromatic structure. Its applications could extend to fields such as organic electronics, sensors, or as intermediates in organic synthesis. However, specific reactivity and stability characteristics would depend on the environmental conditions and the presence of other chemical species.
Formula:C30H51NO6
InChI:InChI=1/C30H51NO6/c1-3-5-7-9-11-13-15-17-19-36-27-21-26(31(24-29(32)33)25-30(34)35)22-28(23-27)37-20-18-16-14-12-10-8-6-4-2/h21-23H,3-20,24-25H2,1-2H3,(H,32,33)(H,34,35)
SMILES:CCCCCCCCCCOc1cc(cc(c1)OCCCCCCCCCC)N(CC(=O)O)CC(=O)O
Synonyms:- glycine, N-[3,5-bis(decyloxy)phenyl]-N-(carboxymethyl)-
- 2,2'-{[3,5-Bis(decyloxy)phenyl]imino}diacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ro 23-9358
CAS:Ro 23-9358 is a potent inhibitor of secretory phospholipase A2, exhibiting anti-inflammatory properties.Formula:C30H51NO6Color and Shape:SolidMolecular weight:521.729

