CAS 153138-05-7
:5-Oxazolecarboxaldehyde, 2-methyl-, ion(1-)
Description:
5-Oxazolecarboxaldehyde, 2-methyl-, ion(1-) is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This substance features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The presence of the methyl group at the 2-position of the oxazole ring contributes to its unique chemical properties, influencing its polarity and solubility. As an ion, it suggests that the compound may exist in a charged state, which can affect its interactions with other molecules and its behavior in various chemical environments. This compound may be of interest in fields such as medicinal chemistry, agrochemicals, or materials science due to its potential biological activity and utility in synthetic pathways. However, specific details regarding its physical properties, reactivity, and applications would require further investigation and analysis in the context of its chemical behavior and interactions.
Formula:C5H4NO2
InChI:InChI=1S/C5H4NO2/c1-4-6-2-5(3-7)8-4/h2-3H,1H2/q-1
InChI key:InChIKey=LOSMNERSKQHIBO-UHFFFAOYSA-N
SMILES:C(=O)C=1OC([CH2-])=NC1
Synonyms:- 5-Oxazolecarboxaldehyde, 2-methyl-, ion(1-)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
