
CAS 1531600-36-8
:2-Carboxy-3-hydroxy-5-methoxy-L-phenylalanine
Description:
2-Carboxy-3-hydroxy-5-methoxy-L-phenylalanine, also known by its CAS number 1531600-36-8, is an amino acid derivative that features a phenylalanine backbone with additional functional groups. This compound is characterized by the presence of a carboxylic acid group (-COOH), a hydroxyl group (-OH), and a methoxy group (-OCH3) attached to the aromatic ring. These functional groups contribute to its polar nature, enhancing its solubility in water compared to non-polar amino acids. The presence of the hydroxyl group can also facilitate hydrogen bonding, which may influence its reactivity and interactions in biological systems. As a derivative of phenylalanine, it retains the essential amino acid properties, making it relevant in biochemical pathways, particularly in the synthesis of neurotransmitters. Its unique structure may also impart specific biological activities, making it of interest in pharmacological and nutritional research. Overall, 2-Carboxy-3-hydroxy-5-methoxy-L-phenylalanine exemplifies the complexity and diversity of amino acid derivatives in biochemical contexts.
Formula:C11H13NO6
InChI:InChI=1S/C11H13NO6/c1-18-6-2-5(3-7(12)10(14)15)9(11(16)17)8(13)4-6/h2,4,7,13H,3,12H2,1H3,(H,14,15)(H,16,17)/t7-/m0/s1
InChI key:InChIKey=DYJIDGJHOLTGBO-ZETCQYMHSA-N
SMILES:C([C@@H](C(O)=O)N)C1=C(C(O)=O)C(O)=CC(OC)=C1
Synonyms:- L-Phenylalanine, 2-carboxy-3-hydroxy-5-methoxy-
- Caramboxin
- 2-Carboxy-3-hydroxy-5-methoxy-L-phenylalanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Caramboxin
CAS:Caramboxin, a neurotoxin, can induce acute kidney injury.Formula:C11H13NO6Color and Shape:SolidMolecular weight:255.22
