CAS 1532-71-4

1-Bromoisoquinoline

Description:

1-Bromoisoquinoline is an organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 1-position of the isoquinoline ring significantly influences its chemical properties and reactivity. This compound typically appears as a pale yellow to brownish liquid or solid, depending on its purity and form. It is known for its role as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. 1-Bromoisoquinoline exhibits moderate solubility in organic solvents, such as ethanol and dichloromethane, but is less soluble in water due to its hydrophobic nature. The compound can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable building block in synthetic chemistry. Additionally, its bromine substituent can serve as a leaving group, facilitating further functionalization of the isoquinoline core. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₉H₆BrN

InChI: InChI=1/C9H6BrN/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-6H

SMILES: c1ccc2c(c1)ccnc2Br

Synonyms:

• 1-Bromoisoquinoline, 95+%

1-Bromoisoquinoline

CAS: 1532-71-4

Formula: C₉H₆BrN

Purity: >98.0%(T)

Color and Shape: White to Light yellow powder to lump

Molecular weight: 208.06

Ref: 3B-B3445

1-Bromoisoquinoline

CAS: 1532-71-4

Formula: C₉H₆BrN

Purity: 96%

Color and Shape: Solid

Molecular weight: 208.0546

Ref: IN-DA0032Q7

1-Bromoisoquinoline

CAS: 1532-71-4

1-Bromoisoquinoline

Formula: C₉H₆BrN

Purity: ≥95%

Color and Shape: yellow solid

Molecular weight: 208.05g/mol

Ref: 54-OR59454

1-Bromoisoquinoline

CAS: 1532-71-4

Formula: C₉H₆BrN

Molecular weight: 208.06

Ref: 4Z-I-4821

1-Bromoisoquinoline

CAS: 1532-71-4

Formula: C₉H₆BrN

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.058

Ref: 10-F048784