CAS 153254-09-2
:2,4-Bis(trifluoromethyl)phenylboronic acid
Description:
2,4-Bis(trifluoromethyl)phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has two trifluoromethyl substituents at the 2 and 4 positions. This compound typically appears as a white to off-white solid and is known for its high reactivity, particularly in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis and materials science. The trifluoromethyl groups enhance the lipophilicity and electronic properties of the molecule, contributing to its utility in various chemical applications. Additionally, the boronic acid moiety allows for the formation of stable complexes with diols, which is significant in the development of sensors and drug delivery systems. Its solubility in organic solvents and moderate stability under ambient conditions further facilitate its use in laboratory settings. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H5BF6O2
InChI:InChI=1S/C8H5BF6O2/c10-7(11,12)4-1-2-6(9(16)17)5(3-4)8(13,14)15/h1-3,16-17H
InChI key:InChIKey=WLYPBMBWKYALCG-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(B(O)O)C=CC(C(F)(F)F)=C1
Synonyms:- (2,4-Ditrifluoromethylphenyl)boronic acid
- 2,4-Bis(trifluoromethyl)phenylboronic acid
- 2,4-Di(trifluoromethyl)benzeneboronic acid
- B-[2,4-Bis(trifluoromethyl)phenyl]boronic acid
- Boronic acid, B-[2,4-bis(trifluoromethyl)phenyl]-
- Boronic acid, [2,4-bis(trifluoromethyl)phenyl]-
- [2′,4′-Bis(trifluoromethyl)phenyl]boronic acid
- 2,4-Bis(trifluoromethyl)benzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,4-Bis(trifluoromethyl)benzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H5BF6O2Purity:97%Color and Shape:White to cream, PowderMolecular weight:257.932,4-Bis(trifluoromethyl)phenylboronic acid
CAS:Formula:C8H5BF6O2Purity:98%Color and Shape:SolidMolecular weight:257.92552,4-Bis(trifluoromethyl)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H5BF6O2Purity:97.0 to 108.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:257.932,4-Bis(trifluoromethyl)benzeneboronic acid
CAS:2,4-Bis(trifluoromethyl)benzeneboronic acidFormula:C8H5BF6O2Purity:98%Color and Shape: white. crystalline solidMolecular weight:257.93g/mol2,4-Bis(trifluoromethyl)phenylboronic acid
CAS:Formula:C8H5BF6O2Purity:98%Color and Shape:SolidMolecular weight:257.93





