CAS 153265-90-8

1D-1-O-BUTYRYL-4 6-O-DIBENZOYL-MYO-INO-

Description:

The chemical substance known as "1D-1-O-BUTYRYL-4 6-O-DIBENZOYL-MYO-INO-" with CAS number 153265-90-8 is a derivative of myo-inositol, which is a carbohydrate and a member of the vitamin B complex. This compound features multiple acyl groups, specifically butyryl and dibenzoyl moieties, which contribute to its chemical properties and potential biological activity. The presence of these acyl groups suggests that the compound may exhibit lipophilic characteristics, potentially influencing its solubility and interaction with biological membranes. Additionally, the structural modifications may enhance its stability and bioavailability compared to unmodified myo-inositol. Such derivatives are often investigated for their roles in cellular signaling pathways and their potential therapeutic applications, particularly in metabolic disorders and neurodegenerative diseases. However, specific data regarding its pharmacokinetics, toxicity, and detailed biological effects would require further empirical studies to elucidate its full profile.

Formula: C₃₂H₂₅NO₄

InChI: InChI=1/C32H25NO4/c34-31(35)30(18-28-22-11-3-1-9-20(22)17-21-10-2-4-12-23(21)28)33-32(36)37-19-29-26-15-7-5-13-24(26)25-14-6-8-16-27(25)29/h1-17,29-30H,18-19H2,(H,33,36)(H,34,35)/t30-/m0/s1

SMILES: c1ccc2c(c1)cc1ccccc1c2C[C@@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12

Synonyms:

• 3-anthracen-9-yl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanine

1D-1-O-Butyryl-4,6-O-dibenzoyl-myo-inositol

CAS: 153265-90-8

Ref: 7W-GC5231

1D-1-O-Butyryl-4,6-O-dibenzoyl-myo-inositol

CAS: 153265-90-8

1D-1-O-Butyryl-4,6-O-dibenzoyl-myo-inositol is an oligosaccharide that has been modified with fluoride. It is a custom synthesis of a complex carbohydrate and its CAS number is 153265-90-8. 1D-1-O-Butyryl-4,6-O-dibenzoyl-myo-inositol is used in the synthesis of saccharides and polysaccharides.

Formula: C₂₄H₂₆O₉

Purity: Min. 95%

Molecular weight: 458.46 g/mol

Ref: 3D-MB29977