CAS 153312-51-7
:Thiophene, 3-(4-fluorophenyl)-, homopolymer
Description:
Thiophene, 3-(4-fluorophenyl)-, homopolymer is a synthetic polymer derived from the polymerization of thiophene derivatives, specifically featuring a 4-fluorophenyl substituent. This compound exhibits characteristics typical of conjugated polymers, including electrical conductivity and optical properties, making it of interest in organic electronics and materials science. The presence of the fluorophenyl group can enhance the polymer's stability and solubility, while also influencing its electronic properties. The polymer's structure allows for π-π stacking interactions, which can affect its mechanical strength and thermal stability. Additionally, thiophene-based polymers are known for their ability to form thin films, which are useful in applications such as organic light-emitting diodes (OLEDs), organic photovoltaics (OPVs), and field-effect transistors (OFETs). The specific properties of this homopolymer, such as its molecular weight, conductivity, and thermal behavior, can vary based on the polymerization method and conditions used during synthesis. Overall, this compound represents a versatile material with potential applications in advanced electronic devices.
Formula:(C10H7FS)x
InChI:InChI=1S/C10H7FS/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-7H
InChI key:InChIKey=WUOUBJDINSHIPE-UHFFFAOYSA-N
SMILES:FC1=CC=C(C=C1)C=2C=CSC2
Synonyms:- Thiophene, 3-(4-fluorophenyl)-, homopolymer
- Poly(4-fluorophenylthiophene)
- Poly-3-(4-fluorophenyl)thiophene
- 3-(4-Fluorophenyl)thiophene homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
