CAS 153322-50-0
:N,N'-diacetylchitobiosyl allosamizoline
Description:
N,N'-diacetylchitobiosyl allosamizoline is a complex chemical compound that features a combination of carbohydrate and nitrogen-containing moieties. It is derived from chitobiose, which is a disaccharide composed of two N-acetylglucosamine units linked by a β(1→4) bond. The presence of the "N,N'-diacetyl" groups indicates that the amine functionalities in the chitobiose structure are acetylated, enhancing solubility and stability. The term "allosamizoline" suggests the presence of a specific nitrogen-containing heterocyclic structure, which may impart unique biological activities or interactions. This compound is likely to exhibit properties typical of glycosylated compounds, such as potential antimicrobial or immunomodulatory effects, due to its carbohydrate components. Additionally, its structural complexity may influence its solubility, reactivity, and interactions with biological systems. Overall, N,N'-diacetylchitobiosyl allosamizoline represents a fascinating area of study in carbohydrate chemistry and its applications in biochemistry and pharmaceuticals.
Formula:C25H42N4O14
InChI:InChI=1/C25H42N4O14/c1-8(33)26-14-17(36)16(35)11(6-31)39-23(14)42-22-12(7-32)40-24(15(19(22)38)27-9(2)34)41-21-10(5-30)20-13(18(21)37)28-25(43-20)29(3)4/h10-24,30-32,35-38H,5-7H2,1-4H3,(H,26,33)(H,27,34)/t10-,11+,12+,13+,14+,15+,16+,17+,18+,19+,20-,21+,22+,23-,24-/m0/s1
Synonyms:- 2-(Dimethylamino)-4-hydroxy-6-(hydroxymethyl)-3a,5,6,6a-tetrahydro-4H-cyclopentoxazol-5-yl 2-acetamido-4-O-(2-acetamido-2-deoxyglucopyranosyl)-2-deoxyglucopyranoside
- N,N'-Diacetyl-beta-chitobiosyl allosamizoline
- (3aR,4R,5R,6S,6aS)-2-(dimethylamino)-4-hydroxy-6-(hydroxymethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazol-5-yl 2-(acetylamino)-4-O-[2-(acetylamino)-2-deoxy-beta-D-glucopyranosyl]-2-deoxy-beta-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N,N'-Diacetylchitobiosyl allosamizoline
CAS:<p>N,N'-Diacetylchitobiosyl allosamizoline is an analog of the insect-inhibiting allosamidin. It has been shown to have inhibitory activity against chitinases and it is a stereoselective inhibitor of chitin synthase. N,N'-Diacetylchitobiosyl allosamizoline is used as a substrate in coupling reactions to produce disaccharides that contain the chitobiose unit. This type of enzyme inhibition may be useful in combating insects that feed on plants or other organisms with exoskeletons made up of chitin.</p>Formula:C25H42N4O14Purity:Min. 95%Molecular weight:622.62 g/mol
