CAS 1533519-86-6

N-(4-Cyclopropyl-1-naphthalenyl)-2-formylhydrazinecarbothioamide

Description:

N-(4-Cyclopropyl-1-naphthalenyl)-2-formylhydrazinecarbothioamide is a chemical compound characterized by its complex structure, which includes a cyclopropyl group, a naphthalene moiety, and a hydrazinecarbothioamide functional group. This compound features a hydrazine linkage, which is known for its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the formyl group suggests that it may participate in various chemical reactions, such as condensation or nucleophilic addition. The cyclopropyl group can impart unique steric and electronic properties, influencing the compound's reactivity and interactions with biological targets. Additionally, the naphthalene structure contributes to the compound's aromatic character, which can enhance stability and solubility in organic solvents. Overall, this compound may exhibit interesting biological activities, making it a candidate for further research in drug development or as a chemical intermediate in synthetic pathways. Its specific properties, such as solubility, melting point, and reactivity, would require empirical investigation for detailed characterization.

Formula: C₁₅H₁₅N₃OS

InChI: InChI=1S/C15H15N3OS/c19-9-16-18-15(20)17-14-8-7-11(10-5-6-10)12-3-1-2-4-13(12)14/h1-4,7-10H,5-6H2,(H,16,19)(H2,17,18,20)

InChI key: InChIKey=HGCUOCICQCDBJN-UHFFFAOYSA-N

SMILES: N(C(NNC=O)=S)C=1C2=C(C(=CC1)C3CC3)C=CC=C2

Synonyms:

• Hydrazinecarbothioamide, N-(4-cyclopropyl-1-naphthalenyl)-2-formyl-
• N-(4-Cyclopropyl-1-naphthalenyl)-2-formylhydrazinecarbothioamide

Lesinurad Impurity 33

CAS: 1533519-86-6

Formula: C₁₅H₁₅N₃OS

Molecular weight: 285.37

Ref: 4Z-L-109040