CAS 1534-27-6
:3-Dodecanone
Description:
3-Dodecanone, with the CAS number 1534-27-6, is a saturated ketone characterized by a 12-carbon chain with a carbonyl group (C=O) located at the third carbon atom. This compound is part of the larger family of aliphatic ketones and exhibits a distinct, pleasant odor, often described as waxy or fatty, which makes it useful in flavoring and fragrance applications. It is a colorless to pale yellow liquid at room temperature and is relatively non-volatile. 3-Dodecanone is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. The compound has a moderate boiling point and a relatively low vapor pressure, indicating that it is stable under standard conditions. Additionally, it can participate in various chemical reactions typical of ketones, such as oxidation and reduction, making it a versatile intermediate in organic synthesis. Its applications extend to the food industry, cosmetics, and potentially in the synthesis of other organic compounds.
Formula:C12H24O
InChI:InChI=1S/C12H24O/c1-3-5-6-7-8-9-10-11-12(13)4-2/h3-11H2,1-2H3
InChI key:InChIKey=PERIHWAPLOBAJM-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)C(CC)=O
Synonyms:- 3-Dodecanone
- Dodecan-3-one
- Ethyl nonyl ketone
- NSC 158522
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
