CAS 1534-35-6
:Isolithocholic acid
Description:
Isolithocholic acid, with the CAS number 1534-35-6, is a bile acid derivative that is structurally related to lithocholic acid. It is characterized by its steroidal structure, which consists of a four-ring core typical of steroid compounds. Isolithocholic acid is known for its hydrophobic properties, which influence its solubility and interaction with biological membranes. This compound plays a role in the digestion and absorption of dietary fats and fat-soluble vitamins in the intestine. Additionally, it is involved in the regulation of cholesterol metabolism and has been studied for its potential effects on various physiological processes, including its influence on gut microbiota and metabolic pathways. Isolithocholic acid can be synthesized from cholesterol through a series of enzymatic reactions in the liver. Its biological activity and potential therapeutic applications are areas of ongoing research, particularly in relation to metabolic disorders and liver function. As with many bile acids, its concentration and balance are crucial for maintaining overall health.
Formula:C24H40O3
InChI:InChI=1S/C24H40O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h15-21,25H,4-14H2,1-3H3,(H,26,27)/t15-,16-,17+,18+,19-,20+,21+,23+,24-/m1/s1
InChI key:InChIKey=SMEROWZSTRWXGI-WFVDQZAMSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@](CC3)(C[C@@H](O)CC4)[H])(CC1)[H])[H])(CC[C@@]2([C@@H](CCC(O)=O)C)[H])[H]
Synonyms:- (3beta,5beta)-3-Hydroxycholan-24-oic acid
- (3β,5β)-3-Hydroxycholan-24-oic acid
- 3-Epilithocholic acid
- 3β-Hydroxy-5β-cholan-24-oic acid
- 3β-Hydroxy-5β-cholanic acid
- 3β-Hydroxy-5β-cholanoic acid
- 3β-Lithocholic acid
- 5β-Cholan-24-oic acid, 3β-hydroxy-
- 5β-Cholanic acid, 3β-hydroxy-
- 5β-Cholanic acid-3β-ol
- Cholan-24-oic acid, 3-hydroxy-, (3beta,5beta)-
- Cholan-24-oic acid, 3-hydroxy-, (3β,5β)-
- Isolithocholic acid
- β-Lithocholanic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(3beta,5beta)-3-Hydroxycholan-24-oic acid
CAS:Applications (3β,5β)-3-Hydroxycholan-24-oic acid has been used for the study of the activation of β1 subunit-containing BK channels with respect to the structure of monohydroxylated bile acids.
References Bukiya, A.N., ey al.: J. Lipid. Res., 49, 2441-2451 (2008)Formula:C24H40O3Color and Shape:NeatMolecular weight:376.57Isolithocholic acid
CAS:Controlled ProductIsolithocholic acid is a bile acid derivative, which is a secondary bile acid formed by the action of intestinal bacteria. Its source lies primarily in the microbial metabolism of primary bile acids within the digestive tract. Isolithocholic acid's mode of action involves interaction with nuclear receptors such as the Farnesoid X receptor (FXR), which play critical roles in the regulation of bile acid, lipid, and glucose metabolism.Formula:C24H40O3Purity:Min. 95%Molecular weight:376.6 g/molIsolithocholic Acid
CAS:Isolithocholic Acid, a bile acid isomer, forms through microbial metabolism of Lithocholic acid or its 3α-sulfate.Formula:C24H40O3Purity:99.56% - 99.84%Color and Shape:SolidMolecular weight:376.57





