CAS 1534-35-6: Isolithocholic acid
Description:Isolithocholic acid, with the CAS number 1534-35-6, is a bile acid derivative that is structurally related to lithocholic acid. It is characterized by its steroidal structure, which consists of a four-ring core typical of steroid compounds. Isolithocholic acid is known for its hydrophobic properties, which influence its solubility and interaction with biological membranes. This compound plays a role in the digestion and absorption of dietary fats and fat-soluble vitamins in the intestine. Additionally, it is involved in the regulation of cholesterol metabolism and has been studied for its potential effects on various physiological processes, including its influence on gut microbiota and metabolic pathways. Isolithocholic acid can be synthesized from cholesterol through a series of enzymatic reactions in the liver. Its biological activity and potential therapeutic applications are areas of ongoing research, particularly in relation to metabolic disorders and liver function. As with many bile acids, its concentration and balance are crucial for maintaining overall health.
Formula:C24H40O3
InChI:InChI=1S/C24H40O3/c1-15(4-9-22(26)27)19-7-8-20-18-6-5-16-14-17(25)10-12-23(16,2)21(18)11-13-24(19,20)3/h15-21,25H,4-14H2,1-3H3,(H,26,27)/t15-,16-,17+,18+,19-,20+,21+,23+,24-/m1/s1
InChI key:InChIKey=SMEROWZSTRWXGI-WFVDQZAMSA-N
SMILES:O=C(O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CCC12C
- Synonyms:
- (3beta,5beta)-3-Hydroxycholan-24-oic acid
- (3β,5β)-3-Hydroxycholan-24-oic acid
- 3-Epilithocholic acid
- 3β-Hydroxy-5β-cholan-24-oic acid
- 3β-Hydroxy-5β-cholanic acid
- 3β-Hydroxy-5β-cholanoic acid
- 3β-Lithocholic acid
- 5β-Cholan-24-oic acid, 3β-hydroxy-
- 5β-Cholanic acid, 3β-hydroxy-
- 5β-Cholanic acid-3β-ol
- See more synonyms
- Cholan-24-oic acid, 3-hydroxy-, (3beta,5beta)-
- Cholan-24-oic acid, 3-hydroxy-, (3β,5β)-
- Isolithocholic acid
- β-Lithocholanic acid
- β-Lithocholic acid
