CymitQuimica logo

CAS 153404-60-5

:

Benzene, 1,1'-(1,2-ethynediyl)bis[3-bromo-

Description:
Benzene, 1,1'-(1,2-ethynediyl)bis[3-bromo-] is an organic compound characterized by its structure, which features a central ethynediyl group connecting two brominated benzene rings. The presence of bromine atoms introduces significant polarity and reactivity, making this compound a potential candidate for various chemical reactions, including electrophilic substitution and cross-coupling reactions. The ethynediyl linkage contributes to the compound's rigidity and can influence its electronic properties, potentially enhancing its utility in materials science and organic synthesis. This compound may exhibit notable thermal stability and solubility characteristics, depending on the solvent used. Additionally, due to the presence of bromine, it may have applications in medicinal chemistry or as an intermediate in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, Benzene, 1,1'-(1,2-ethynediyl)bis[3-bromo-] represents a unique structure with potential applications in various fields of chemistry.
Formula:C14H8Br2
InChI:InChI=1S/C14H8Br2/c15-13-5-1-3-11(9-13)7-8-12-4-2-6-14(16)10-12/h1-6,9-10H
InChI key:WSXUXTVJTIPBAF-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)Br)C#CC2=CC(=CC=C2)Br
Synonyms:
  • 3,3'-Dibromotolane
  • Bis(3-bromophenyl)acetylene &gt
  • Benzene, 1,1'-(1,2-ethynediyl)bis[3-bromo-
Found 3 products.