CAS 1535-65-5
:Difluoromethyl phenyl sulfone
Description:
Difluoromethyl phenyl sulfone, with the CAS number 1535-65-5, is an organic compound characterized by the presence of a sulfone functional group attached to a phenyl ring and a difluoromethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its relatively high stability and resistance to various chemical reactions, making it useful in synthetic organic chemistry. The difluoromethyl group imparts unique electronic properties, which can enhance the compound's reactivity in certain reactions, such as nucleophilic substitutions. Additionally, difluoromethyl phenyl sulfone may exhibit moderate solubility in organic solvents, while its solubility in water is generally low. Due to its sulfone moiety, it may also display some polar characteristics. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, where it can serve as an intermediate or building block in the synthesis of more complex molecules. Safety precautions should be observed when handling this substance, as it may pose health risks.
Formula:C7H6F2O2S
InChI:InChI=1S/C7H6F2O2S/c8-7(9)12(10,11)6-4-2-1-3-5-6/h1-5,7H
SMILES:c1ccc(cc1)S(=O)(=O)C(F)F
Synonyms:- [(Difluoromethyl)sulfonyl]benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Difluoromethyl Phenyl Sulfone
CAS:Formula:C7H6F2O2SPurity:>98.0%(GC)Color and Shape:White or Colorless to Almost white or Almost colorless powder to lump to clear liquidMolecular weight:192.18Difluoromethyl phenyl sulfone, 95%
CAS:Used as a reagent for the nucleophilic difluoro(phenylsulfonyl)methylation of carbonyls and fluorination. Reagent used for reductive silylation and the preparation of trifluoro- and difluoromethylsilanes by reductive coupling of fluoromethyl sulfones, sulfoxides and sulfides with chlorosilanes, fluFormula:C7H6F2O2SPurity:95%Molecular weight:192.18Difluoromethyl phenyl sulfone
CAS:Formula:C7H6F2O2SPurity:98%Color and Shape:LiquidMolecular weight:192.1831((Difluoromethyl)sulfonyl)benzene
CAS:((Difluoromethyl)sulfonyl)benzeneFormula:C7H6F2O2SPurity:98%Color and Shape: colourless solidMolecular weight:192.18g/mol((Difluoromethyl)sulfonyl)benzene
CAS:Formula:C7H6F2O2SPurity:95%Color and Shape:LiquidMolecular weight:192.18





