CAS 153502-27-3
:Trimethylsilylethylhydroxylaminehydrochloride
Description:
Trimethylsilylethylhydroxylamine hydrochloride is a chemical compound characterized by its unique structure, which includes a trimethylsilyl group, an ethyl chain, and a hydroxylamine functional group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in polar solvents. It is often used in organic synthesis, particularly in the field of organosilicon chemistry, where it serves as a reagent for various transformations, including the protection of amines and the introduction of silicon functionalities into organic molecules. The presence of the hydroxylamine group allows for potential applications in the formation of oximes and in the reduction of carbonyl compounds. Additionally, the trimethylsilyl group can provide stability and enhance the volatility of the compound, making it useful in gas chromatography. Safety data indicates that, like many organosilicon compounds, it should be handled with care, as it may pose risks such as irritation or toxicity upon exposure. Proper laboratory practices and safety protocols are essential when working with this substance.
Formula:C5H16ClNOSi
InChI:InChI=1/C5H15NOSi.ClH/c1-8(2,3)5-4-7-6;/h4-6H2,1-3H3;1H
SMILES:C[Si](C)(C)CCON.Cl
Synonyms:- [2-(Aminooxy)Ethyl](Trimethyl)Silane Hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
O-(2-Trimethylsilylethyl)hydroxylamine HCl
CAS:Formula:C5H16ClNOSiPurity:98%Color and Shape:SolidMolecular weight:169.7251O-(2-Trimethylsilylethyl)hydroxylamine Hydrochloride
CAS:Formula:C5H15NOSi·HClPurity:>98.0%(N)Color and Shape:White to Light yellow powder to crystalMolecular weight:169.72O-(2-Trimethylsilylethyl)hydroxylamine-hydrochloride
CAS:S19430 - O-(2-Trimethylsilylethyl)hydroxylamine-hydrochloride
Formula:C5H16ClNOSiPurity:>98.0%(N)Color and Shape:SolidMolecular weight:169.72O-(2-Trimethylsilylethyl)hydroxylamine HCl
CAS:O-(2-Trimethylsilylethyl)hydroxylamine HCl is a fine chemical that can be used as a versatile building block in the synthesis of complex compounds. It is also an intermediate for research chemicals, reagents, and speciality chemicals. O-(2-Trimethylsilylethyl)hydroxylamine HCl can be used as a reaction component in organic synthesis and has been shown to be useful in the synthesis of new scaffolds.
Formula:C5H15NOSi·HClPurity:Min. 95%Color and Shape:White PowderMolecular weight:169.72 g/mol



