CAS 153505-37-4: 4-Bromo-5-fluoro-1,2-benzenediamine

Description:4-Bromo-5-fluoro-1,2-benzenediamine is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring, along with two amino groups. This compound features a dichloro-substituted aromatic structure, which contributes to its unique chemical properties. The bromine and fluorine atoms introduce significant electronegativity differences, influencing the compound's reactivity and potential applications in various chemical reactions, such as nucleophilic substitutions. The amino groups provide basicity and can participate in hydrogen bonding, making the compound potentially useful in pharmaceuticals and materials science. Additionally, the presence of halogens can enhance the compound's lipophilicity, affecting its solubility and interaction with biological systems. The compound's CAS number, 153505-37-4, allows for easy identification in chemical databases, facilitating research and development in synthetic chemistry and related fields. Overall, 4-Bromo-5-fluoro-1,2-benzenediamine is a versatile compound with applications in medicinal chemistry and as an intermediate in organic synthesis.

Formula:C₆H₆BrFN₂

InChI:InChI=1S/C6H6BrFN2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H,9-10H2

InChI key:InChIKey=NDXWAQNAHFBGML-UHFFFAOYSA-N

SMILES:FC=1C=C(N)C(N)=CC1Br

Synonyms:
1,2-Benzenediamine, 4-bromo-5-fluoro-
4-Bromo-5-Fluorobenzene-1,2-Diamine
4-Bromo-5-fluoro-1,2-benzenediamine
5-Bromo-4-fluoro-1,2-phenylenediamine
4-Bromo-5-fluoro-1,2-phenylenediamine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1,2-Benzenediamine, 4-bromo-5-fluoro- REF: IN-DA00365KCAS: 153505-37-4	96%	To inquire	Wed 26 Mar 25
4-Bromo-5-fluorobenzene-1,2-diamine REF: 54-PC9574CAS: 153505-37-4	97%	32.00 €~366.00 €	Thu 27 Mar 25
4-Bromo-5-fluorobenzene-1,2-diamine REF: 10-F233334CAS: 153505-37-4	95.0%	To inquire	Mon 07 Apr 25
4-Bromo-5-Fluoro-1,2-Benzenediamine REF: 3D-FB82409CAS: 153505-37-4	Min. 95%	- - -	Discontinued product