CAS 153595-93-8: 5-(1H-Indol-3-ylmethyl)-1,3,4-thiadiazol-2-amine

Description:5-(1H-Indol-3-ylmethyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structural features, which include an indole moiety and a thiadiazole ring. The indole part contributes to its potential biological activity, as indole derivatives are known for their roles in various pharmacological applications. The thiadiazole ring, containing sulfur and nitrogen atoms, enhances the compound's chemical reactivity and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The presence of both aromatic and heterocyclic components may also impart interesting electronic properties, making it a candidate for further research in fields such as drug discovery and materials science. Overall, 5-(1H-Indol-3-ylmethyl)-1,3,4-thiadiazol-2-amine represents a class of compounds that could be explored for their biological significance and utility in various chemical applications.

Formula:C₁₁H₁₀N₄S

InChI:InChI=1S/C11H10N4S/c12-11-15-14-10(16-11)5-7-6-13-9-4-2-1-3-8(7)9/h1-4,6,13H,5H2,(H2,12,15)

InChI key:InChIKey=SCTCFEMYJYGVJN-UHFFFAOYSA-N

SMILES:N=1N=C(SC1N)CC2=CNC=3C=CC=CC32