CAS 153607-44-4
:1-[2-(bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethyl]-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine
Description:
1-[2-(Bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethyl]-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine, with CAS number 153607-44-4, is a complex organic compound characterized by its unique bicyclic structure and piperazine moiety. This substance features a bicyclo[4.2.0]octatriene framework, which contributes to its potential reactivity and stability under certain conditions. The presence of the 2,3-dihydro-1,4-benzodioxin group adds to its structural diversity and may influence its biological activity. The piperazine ring is known for its ability to form hydrogen bonds and interact with various biological targets, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas requiring modulation of neurotransmitter systems or other biological pathways. However, detailed studies on its pharmacological properties, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses.
Formula:C22H26N2O2
InChI:InChI=1/C22H26N2O2/c1-2-5-19-17(4-1)16-18(19)8-9-23-10-12-24(13-11-23)20-6-3-7-21-22(20)26-15-14-25-21/h1-7,18H,8-16H2
Synonyms:- 1-[2-(Bicyclo[4.2.0]octa-1,3,5-trien-7-yl)ethyl]-4-(2,3-dihydro-1,4-benzodioxin-5-yl)piperazine
- Piperazine, 1-(2-bicyclo(4.2.0)octa-1,3,5-trien-7-ylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)-
- piperazine, 1-(2-bicyclo[4.2.0]octa-1,3,5-trien-7-ylethyl)-4-(2,3-dihydro-1,4-benzodioxin-5-yl)-
- S 14489
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
S 14489
CAS:S 14489 is a benzodioxopiperazine that have been shown to antagonize the 5-HT1A receptor.Formula:C22H26N2O2Color and Shape:SolidMolecular weight:350.45
