CAS 15362-44-4
:2,4,6-Trichloro-N-phenylbenzenamine
Description:
2,4,6-Trichloro-N-phenylbenzenamine, also known as trichlorophenylamine, is an organic compound characterized by the presence of three chlorine atoms and an aniline structure. It features a phenyl group attached to a benzenamine backbone, with chlorine substituents located at the 2, 4, and 6 positions of the aromatic ring. This compound is typically a solid at room temperature and is known for its potential applications in the synthesis of dyes, pigments, and other organic compounds. The presence of chlorine atoms enhances its reactivity, making it useful in various chemical reactions, including electrophilic aromatic substitution. However, due to the chlorine substituents, it may also exhibit toxicity and environmental persistence, necessitating careful handling and disposal. Its chemical properties include moderate solubility in organic solvents and limited solubility in water. As with many chlorinated compounds, it is important to consider its environmental impact and regulatory status in various jurisdictions.
Formula:C12H8Cl3N
InChI:InChI=1S/C12H8Cl3N/c13-8-6-10(14)12(11(15)7-8)16-9-4-2-1-3-5-9/h1-7,16H
InChI key:InChIKey=HLNRCXQIZGIJSU-UHFFFAOYSA-N
SMILES:N(C1=C(Cl)C=C(Cl)C=C1Cl)C2=CC=CC=C2
Synonyms:- Diphenylamine, 2,4,6-trichloro-
- Benzenamine, 2,4,6-trichloro-N-phenyl-
- 2,4,6-Trichloro-N-phenylbenzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
