CAS 153624-38-5
:(4-Isobutylphenyl)boronic acid
Description:
(4-Isobutylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has an isobutyl substituent at the para position. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and as a reagent in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The boronic acid group also allows for the potential use in sensor technology and drug delivery systems due to its ability to interact with biological molecules. Additionally, (4-Isobutylphenyl)boronic acid may exhibit unique properties based on its molecular structure, such as specific reactivity patterns and stability under various conditions. Safety precautions should be observed when handling this compound, as with all chemical substances, to mitigate any potential hazards.
Formula:C10H15BO2
InChI:InChI=1/C10H15BO2/c1-8(2)7-9-3-5-10(6-4-9)11(12)13/h3-6,8,12-13H,7H2,1-2H3
SMILES:CC(C)Cc1ccc(cc1)B(O)O
Synonyms:- 4-Isobutylphenylboronic Acid
- [4-(2-Methylpropyl)Phenyl]Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Isobutylbenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H15BO2Purity:98%Molecular weight:178.04Boronic acid,B-[4-(2-methylpropyl)phenyl]-
CAS:Formula:C10H15BO2Purity:98%Color and Shape:SolidMolecular weight:178.03594-Isobutylbenzeneboronic acid
CAS:4-Isobutylbenzeneboronic acidFormula:C10H15BO2Purity:98%Color and Shape: white powderMolecular weight:178.04g/mol4-Isobutylphenylboronic acid
CAS:Formula:C10H15BO2Purity:98%Color and Shape:SolidMolecular weight:178.04




