CAS 153624-44-3

4-ISOBUTOXYPHENYLBORONIC ACID

Description:

4-Isobutoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with an isobutoxy group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity with various electrophiles due to the boronic acid moiety, which can participate in Suzuki coupling reactions, making it valuable in organic synthesis and material science. The isobutoxy group enhances its lipophilicity, which can influence its biological activity and interaction with other molecules. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications and drug design. The compound's stability, reactivity, and functionalization potential make it a subject of interest in medicinal chemistry and polymer science. As with many organoboron compounds, handling should be done with care, considering potential toxicity and environmental impact.

Formula: C₁₀H₁₅BO₃

InChI: InChI=1/C10H15BO3/c1-8(2)7-14-10-5-3-9(4-6-10)11(12)13/h3-6,8,12-13H,7H2,1-2H3

SMILES: CC(C)COc1ccc(cc1)B(O)O

Synonyms:

• [4-(2-Methylpropoxy)Phenyl]Boronic Acid
• p-Isobutoxyphenylboronic acid

4-Isobutoxyphenylboronic acid

CAS: 153624-44-3

Formula: C₁₀H₁₅BO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 194.0353

Ref: IN-DA00APVT

4-Isobutoxyphenylboronic acid

CAS: 153624-44-3

4-Isobutoxyphenylboronic acid

Purity: 98%

Molecular weight: 194.04g/mol

Ref: 54-OR360219

(4-Isobutoxyphenyl)boronic acid

CAS: 153624-44-3

Formula: C₁₀H₁₅BO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 194.04

Ref: 10-F228677