CAS 153632-45-2
:1-(1-(5-(2'-fluoroethyl)-2-thienyl)-cyclohexyl)piperidine
Description:
1-(1-(5-(2'-fluoroethyl)-2-thienyl)-cyclohexyl)piperidine, with CAS number 153632-45-2, is a synthetic compound that belongs to the class of piperidine derivatives. This substance is characterized by its complex molecular structure, which includes a piperidine ring, a cyclohexyl group, and a thienyl moiety substituted with a fluorinated ethyl group. The presence of the fluorine atom can enhance the compound's lipophilicity and potentially influence its biological activity. The thienyl ring contributes to the compound's aromatic characteristics, which may affect its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly in the development of novel pharmacological agents. Its specific properties, such as solubility, stability, and reactivity, would depend on the functional groups present and the overall molecular conformation. As with many synthetic compounds, understanding its characteristics requires thorough investigation through experimental studies, including spectroscopic analysis and biological assays, to elucidate its potential applications and effects.
Formula:C17H2618FNS
InChI:InChI=1/C17H26FNS/c18-12-9-15-7-8-16(20-15)17(10-3-1-4-11-17)19-13-5-2-6-14-19/h7-8H,1-6,9-14H2/i18-1
SMILES:C1CCC(CC1)(c1ccc(CC[18F])s1)N1CCCCC1
Synonyms:- Fetcp
- 1-(1-{5-[2-(~18~F)fluoroethyl]thiophen-2-yl}cyclohexyl)piperidine
- 1-(1-(5-(2'-Fluoroethyl)-2-thienyl)-cyclohexyl)piperidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-(1-(5-(2'-Fluoroethyl)-2-Thienyl)-Cyclohexyl)Piperidine
CAS:Controlled Product1-(1-(5-((2'-fluoroethyl)cyclohexyl)-piperidin-1-yl)cyclohexane-1,2,3,4-tetraol is a magnetic nanoparticle that has high specificity and can be used to detect hydroxyapatite. It is synthesized by the reaction of 2-fluoroethanol with 1,3-bis(diphenylphosphino)-propane (dppp) in the presence of potassium carbonate. The reaction solution spontaneously forms a monolayer on a surface such as ceramics or glass. This monolayer shows potential use in detecting hydroxyapatite and other calcium compounds in bone lesions, as well as for desorption and optical properties.Formula:C17H26FNSPurity:Min. 95%Molecular weight:295.46 g/mol
