CAS 153633-01-3
:3-[(2S)-7-{3-[2-(cyclopropylmethyl)-3-methoxy-4-(methylcarbamoyl)phenoxy]propoxy}-8-propyl-3,4-dihydro-2H-chromen-2-yl]propanoic acid
Description:
The chemical substance known as "3-[(2S)-7-{3-[2-(cyclopropylmethyl)-3-methoxy-4-(methylcarbamoyl)phenoxy]propoxy}-8-propyl-3,4-dihydro-2H-chromen-2-yl]propanoic acid," with the CAS number 153633-01-3, is a complex organic compound characterized by its multi-functional structure. It features a chiral center, indicating that it exists in two enantiomeric forms, which can exhibit different biological activities. The presence of a chromenyl moiety suggests potential interactions with biological systems, particularly in pharmacology, where such compounds may act as modulators or inhibitors of specific pathways. Additionally, the inclusion of a cyclopropylmethyl group and a methoxy substituent may influence its lipophilicity and solubility, affecting its pharmacokinetic properties. The carboxylic acid functional group at one end of the molecule indicates potential for ionization, which can impact its interaction with biological targets. Overall, this compound's intricate structure suggests it may have significant therapeutic potential, warranting further investigation into its biological effects and applications.
Formula:C31H41NO7
InChI:InChI=1/C31H41NO7/c1-4-6-23-26(14-10-21-9-11-22(39-29(21)23)12-16-28(33)34)37-17-5-18-38-27-15-13-24(31(35)32-2)30(36-3)25(27)19-20-7-8-20/h10,13-15,20,22H,4-9,11-12,16-19H2,1-3H3,(H,32,35)(H,33,34)/t22-/m0/s1
Synonyms:- 2H-1-benzopyran-2-propanoic acid, 7-[3-[2-(cyclopropylmethyl)-3-methoxy-4-[(methylamino)carbonyl]phenoxy]propoxy]-3,4-dihydro-8-propyl-, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
SC 53228
CAS:SC 53228 is a specific leukotriene B4 receptor antagonist.Formula:C31H41NO7Color and Shape:SolidMolecular weight:539.66
