CAS 153652-70-1: (4S,5R)-3-Benzoyl-2,2-dimethyl-4-phenyloxazolidine-5-carboxylic acid
Description:(4S,5R)-3-Benzoyl-2,2-dimethyl-4-phenyloxazolidine-5-carboxylic acid is a chiral compound characterized by its oxazolidine ring structure, which incorporates both a benzoyl group and a carboxylic acid functional group. This compound exhibits stereochemistry, denoted by its (4S,5R) configuration, indicating specific spatial arrangements of its atoms that can influence its reactivity and interactions in biological systems. The presence of the dimethyl and phenyl groups contributes to its hydrophobic characteristics, while the carboxylic acid group introduces polarity, allowing for potential solubility in polar solvents. This compound may be of interest in pharmaceutical applications due to its structural features, which could facilitate interactions with biological targets. Additionally, its chirality may play a crucial role in determining its biological activity and pharmacokinetics. Overall, (4S,5R)-3-Benzoyl-2,2-dimethyl-4-phenyloxazolidine-5-carboxylic acid represents a complex organic molecule with potential utility in medicinal chemistry and related fields.
Formula:C19H19NO4
InChI:InChI=1/C19H19NO4/c1-19(2)20(17(21)14-11-7-4-8-12-14)15(16(24-19)18(22)23)13-9-5-3-6-10-13/h3-12,15-16H,1-2H3,(H,22,23)/t15-,16+/m0/s1
- Synonyms:
- 3-Benzoyl-2,2-Dimethyl-4-Phenyl-Oxazolidinecarboxulic Acid
- (4S,5R)-3,5-OxazolidinedicarboxylicAcid,2,2-Dimethyl-4-PhenylEster
- (4S,5R)-3-(N- benzoyl)-2,2-dimethyl-4-phenyloxazolidine-5-carboxylic acid
- Side Chains Of Paclitaxel--5
- (4S,5R)-3-benzoyl-2,2-dimethyl-4-phenyl-1,3-oxazolidine-5-carboxylic acid
- (4R,5S)-3-Benzoyl-2,2-dimethyl-4-phenyloxazolidine-5-carboxylicacid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-Oxazolidinecarboxylic acid, 3-benzoyl-2,2-dimethyl-4-phenyl-,(4S,5R)- REF: IN-DA00HY5JCAS: 153652-70-1 | 95% | To inquire | Wed 26 Mar 25 |
![]() | (4S,5R)-3-Benzoyl-2,2-dimethyl-4-phenyloxazolidine-5-carboxylic acid REF: 10-F076884CAS: 153652-70-1 | 95.0% | - - - | Discontinued product |
![]() | (4S,5R)-3-Benzoyl-2,2-dimethyl-4-phenyloxazolidine-5-carboxylic acid REF: 3D-FB140319CAS: 153652-70-1 | Min. 95% | - - - | Discontinued product |

5-Oxazolidinecarboxylic acid, 3-benzoyl-2,2-dimethyl-4-phenyl-,(4S,5R)-
Ref: IN-DA00HY5J
1g | 111.00 € | ||
5g | 339.00 € | ||
25g | To inquire | ||
250mg | 57.00 € |

(4S,5R)-3-Benzoyl-2,2-dimethyl-4-phenyloxazolidine-5-carboxylic acid
Ref: 10-F076884
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
25g | Discontinued | Request information |

(4S,5R)-3-Benzoyl-2,2-dimethyl-4-phenyloxazolidine-5-carboxylic acid
Ref: 3D-FB140319
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |