CAS 15366-34-4
:1H-pyrazole-3-carboxylic acid methyl ester
Description:
1H-Pyrazole-3-carboxylic acid methyl ester is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a carboxylic acid functional group that is esterified with a methyl group, contributing to its reactivity and solubility properties. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the carboxylate group allows for potential interactions in various chemical reactions, including esterification and amidation. This compound is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Additionally, its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C5H6N2O2
InChI:InChI=1/C5H6N2O2/c1-9-5(8)4-2-3-6-7-4/h2-3H,1H3,(H,6,7)
SMILES:COC(=O)c1cc[nH]n1
Synonyms:- Timtec-Bb Sbb000006
- methyl 1H-pyrazole-3-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl Pyrazole-3-carboxylate
CAS:Formula:C5H6N2O2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:126.12Methyl 1H-pyrazole-3-carboxylate, 97%
CAS:Methyl 1H-pyrazole-3-carboxylate is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or S
Formula:C5H6N2O2Purity:97%Color and Shape:White, PowderMolecular weight:126.12METHYL 1H-PYRAZOLE-3-CARBOXYLATE
CAS:Formula:C5H6N2O2Purity:97%Color and Shape:SolidMolecular weight:126.1133Methyl 1H-pyrazole-3-carboxylate
CAS:Methyl 1H-pyrazole-3-carboxylateFormula:C5H6N2O2Purity:98%Color and Shape: white solidMolecular weight:126.11334g/mol1H-Pyrazole-5-carboxylic acid methyl ester
CAS:Formula:C5H6N2O2Purity:97%Color and Shape:SolidMolecular weight:126.115




