CAS 15366-62-8
:4-Bromonicotinic acid
Description:
4-Bromonicotinic acid is an aromatic compound that belongs to the class of heterocyclic carboxylic acids. It features a bromine atom substituted at the fourth position of the pyridine ring, which is a six-membered ring containing one nitrogen atom. This compound is characterized by its carboxylic acid functional group (-COOH) attached to the pyridine ring, which contributes to its acidic properties. 4-Bromonicotinic acid is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. It is often used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, including coupling and substitution reactions. Additionally, the presence of the bromine atom can enhance its reactivity and influence its biological activity. As with many chemical substances, proper handling and safety precautions should be observed due to its potential toxicity and environmental impact.
Formula:C6H4BrNO2
InChI:InChI=1/C6H4BrNO2/c7-5-1-2-8-3-4(5)6(9)10/h1-3H,(H,9,10)
SMILES:c1cncc(c1Br)C(=O)O
Synonyms:- 3-Pyridinecarboxylic acid, 4-bromo-
- 4-Bromnicotins?ure
- 4-Bromopyridine-3-carboxylic acid
- Acide 4-Bromonicotinique
- Acide 4-bromopyridine-3-carboxylique
- 4-Bromonicotinicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromopyridine-3-carboxylic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H4BrNO2Purity:96%Molecular weight:202.04-Bromopyridine-3-carboxylic acid
CAS:Formula:C6H4BrNO2Purity:95%Color and Shape:SolidMolecular weight:202.00554-Bromopyridine-3-carboxylic acid
CAS:4-Bromopyridine-3-carboxylic acidFormula:C6H4BrNO2Purity:tech. 90%Color and Shape: pale yellow powderMolecular weight:202.01g/mol



