CymitQuimica logo

CAS 15366-63-9

:

4-IODONICOTINIC ACID

Description:
4-Iodononicotinic acid is a chemical compound characterized by the presence of an iodine atom and a carboxylic acid functional group attached to a pyridine ring. Its molecular structure features a pyridine ring substituted at the 4-position with an iodine atom and a carboxylic acid group, which contributes to its acidic properties. This compound is typically a solid at room temperature and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. 4-Iodononicotinic acid is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Additionally, the iodine substituent can enhance the compound's reactivity and influence its biological activity. As with many chemical substances, proper handling and safety precautions are essential, as it may pose health risks if ingested or improperly managed.
Formula:C6H4INO2
InChI:InChI=1/C6H4INO2/c7-5-1-2-8-3-4(5)6(9)10/h1-3H,(H,9,10)
SMILES:c1cncc(c1I)C(=O)O
Synonyms:
  • 4-Iodopyridine-3-Carboxylic Acid
  • 4-Iodo-nicotinic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.