CAS 15367-16-5

2-HYDRAZINO-3-NITROPYRIDINE

Description:

2-Hydrazino-3-nitropyridine is an organic compound characterized by the presence of both hydrazine and nitro functional groups attached to a pyridine ring. Its molecular structure features a pyridine base, which is a six-membered aromatic ring containing one nitrogen atom, with a hydrazino group (-NH-NH2) and a nitro group (-NO2) positioned at the 2 and 3 positions, respectively. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in pharmaceuticals and as a building block in organic synthesis. The presence of the hydrazino group can impart reactivity, making it useful in various chemical reactions, including those involving diazotization or coupling reactions. Additionally, the nitro group can influence the compound's electronic properties and reactivity. As with many nitrogen-containing compounds, 2-hydrazino-3-nitropyridine may pose certain hazards, necessitating careful handling and storage in a controlled environment.

Formula: C₅H₆N₄O₂

InChI: InChI=1/C5H6N4O2/c6-8-5-4(9(10)11)2-1-3-7-5/h1-3H,6H2,(H,7,8)

SMILES: c1cc(c(nc1)NN)N(=O)=O

Synonyms:

• 1-(3-Nitro-2-Pyridyl)Hydrazine
• (3-Nitro-Pyridin-2-Yl)-Hydrazine
• 2-Hydrazino-3-nitropyrdine

2-hydrazino-3-nitropyridine

CAS: 15367-16-5

Formula: C₅H₆N₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 154.1267

Ref: IN-DA00APJE

2-Hydrazino-3-nitropyridine

CAS: 15367-16-5

2-Hydrazino-3-nitropyridine

Formula: C₅H₆N₄O₂

Purity: ≥95%

Color and Shape: dark yellow/orange crystalline solid

Molecular weight: 154.13g/mol

Ref: 54-OR29277

2-Hydrazino-3-nitropyridine

CAS: 15367-16-5

Formula: C₅H₆N₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 154.129

Ref: 10-F068385