CAS 153715-08-3: 9,10-BIS(3,5-DIHYDROXYPHENYL)ANTHRACENE
Description:9,10-Bis(3,5-dihydroxyphenyl)anthracene is an organic compound characterized by its polycyclic aromatic structure, which consists of an anthracene core substituted with two 3,5-dihydroxyphenyl groups. This compound exhibits notable properties such as strong fluorescence and potential applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics. The presence of hydroxyl groups enhances its solubility and can influence its electronic properties, making it a subject of interest in materials science and organic chemistry. Additionally, the compound may exhibit antioxidant properties due to the presence of the hydroxyl groups, which can scavenge free radicals. Its synthesis typically involves multi-step organic reactions, and its stability and reactivity can be influenced by the surrounding environment, such as pH and temperature. Overall, 9,10-bis(3,5-dihydroxyphenyl)anthracene represents a fascinating example of how structural modifications can lead to diverse chemical behaviors and potential applications in advanced materials.
Formula:C26H18O4
InChI:InChI=1/C26H18O4/c27-17-9-15(10-18(28)13-17)25-21-5-1-2-6-22(21)26(24-8-4-3-7-23(24)25)16-11-19(29)14-20(30)12-16/h1-14,27-30H
- Synonyms:
- Anthracene-9, 10-Bis(5-Resorcinol)
- 5,5'-Anthracene-9,10-Diyldibenzene-1,3-Diol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 9,10-BIS(3,5-DIHYDROXYPHENYL)ANTHRACENE REF: IN-DA00AD25CAS: 153715-08-3 | 96% | To inquire | Tue 06 May 25 |
![]() | 9,10-Bis(3,5-Dihydroxyphenyl)Anthracene REF: 54-OR1026934CAS: 153715-08-3 | 96% | 192.00 €~3,774.00 € | Mon 05 May 25 |
![]() | 9,10-Bis(3,5-dihydroxyphenyl)anthracene REF: 3B-B2109CAS: 153715-08-3 | >98.0%(HPLC) | 60.00 €~353.00 € | Wed 07 May 25 |
![]() | 9,10-Bis(3,5-dihydroxyphenyl)anthracene REF: 3D-DGA71508CAS: 153715-08-3 | Min. 95% | - - - | Discontinued product |

9,10-BIS(3,5-DIHYDROXYPHENYL)ANTHRACENE
Ref: IN-DA00AD25
1g | To inquire | ||
100mg | 177.00 € | ||
250mg | 494.00 € |

Ref: 54-OR1026934
1g | 1,026.00 € | ||
5g | 3,774.00 € | ||
100mg | 192.00 € | ||
250mg | 405.00 € |

9,10-Bis(3,5-dihydroxyphenyl)anthracene
Ref: 3B-B2109
1g | 353.00 € | ||
100mg | 60.00 € |

9,10-Bis(3,5-dihydroxyphenyl)anthracene
Ref: 3D-DGA71508
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information |