CymitQuimica logo

CAS 15375-48-1

:

N-(n-Propyl)-phenothiazine

Description:
N-(n-Propyl)-phenothiazine is a chemical compound characterized by its phenothiazine backbone, which consists of a sulfur atom and a nitrogen atom within a three-ring structure. This compound features a propyl group attached to the nitrogen atom of the phenothiazine, influencing its solubility and biological activity. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific formulation. N-(n-Propyl)-phenothiazine is known for its applications in medicinal chemistry, particularly as an antipsychotic and antiemetic agent, due to its ability to interact with neurotransmitter systems. Additionally, it may possess antioxidant properties and has been studied for its potential use in various therapeutic contexts. The compound's stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C15H15NS
InChI:InChI=1/C15H15NS/c1-2-11-16-12-7-3-5-9-14(12)17-15-10-6-4-8-13(15)16/h3-10H,2,11H2,1H3
InChI key:LNXZDZDPYBPHAM-UHFFFAOYSA-N
SMILES:CCCN1c2ccccc2Sc2ccccc12
Synonyms:
  • 10-propyl-10H-phenothiazine
  • N-(n-Propyl)-phenothiazine
Found 4 products.