CymitQuimica logo

CAS 153759-58-1

:

Benzaldehyde, 5-bromo-3-(1,1-dimethylethyl)-2-hydroxy-

Description:
Benzaldehyde, 5-bromo-3-(1,1-dimethylethyl)-2-hydroxy- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a formyl group (aldehyde) and additional functional groups. The presence of a bromine atom at the 5-position and a tert-butyl group at the 3-position contributes to its unique reactivity and physical properties. The hydroxyl group at the 2-position enhances its polarity, making it more soluble in polar solvents compared to non-polar ones. This compound is likely to exhibit typical aldehyde reactivity, such as undergoing oxidation to form carboxylic acids or participating in nucleophilic addition reactions. Its bromine substituent may also influence its reactivity, potentially allowing for further substitution reactions. The tert-butyl group can provide steric hindrance, affecting the compound's overall reactivity and stability. Overall, this compound's structure suggests it may have applications in organic synthesis and as an intermediate in the production of more complex molecules.
Formula:C11H13BrO2
InChI:InChI=1S/C11H13BrO2/c1-11(2,3)9-5-8(12)4-7(6-13)10(9)14/h4-6,14H,1-3H3
InChI key:DTEMRMZXDSDCPQ-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=CC(=CC(=C1O)C=O)Br
Found 5 products.