CAS 15379-30-3
:2',3'-dideoxy-5-fluorouridine
Description:
2',3'-Dideoxy-5-fluorouridine (CAS 15379-30-3) is a nucleoside analog that exhibits significant antiviral properties, particularly against RNA viruses. It is structurally similar to uridine but lacks the hydroxyl groups at the 2' and 3' positions of the ribose sugar, which contributes to its mechanism of action as an inhibitor of viral replication. The presence of a fluorine atom at the 5-position of the uracil base enhances its stability and bioactivity. This compound is often studied for its potential therapeutic applications in treating viral infections, including HIV and hepatitis. Its mechanism involves incorporation into viral RNA, leading to premature termination of viral genome synthesis. Additionally, 2',3'-dideoxy-5-fluorouridine has been investigated for its effects on cellular processes and its potential use in cancer therapy due to its ability to interfere with nucleic acid synthesis. Overall, this compound represents a significant area of research in medicinal chemistry and virology.
Formula:C9H11FN2O4
InChI:InChI=1/C9H11FN2O4/c10-6-3-12(9(15)11-8(6)14)7-2-1-5(4-13)16-7/h3,5,7,13H,1-2,4H2,(H,11,14,15)/t5-,7+/m0/s1
Synonyms:- 15379-30-3
- 5-Fluoro-1-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidine-2,4(1H,3H)-dione
- 5-fluoro-4-hydroxy-1-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidin-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2',3'-Dideoxy-5-fluoro-uridine
CAS:Nucleoside Derivatives - 2’,3’-Dideoxy-nucleoside; Fluoro-modified nucleosideFormula:C9H11FN2O4Color and Shape:SolidMolecular weight:230.19
