CAS 15379-45-0
:3-ethyl-1,3-dihydro-2H-indol-2-one
Description:
3-Ethyl-1,3-dihydro-2H-indol-2-one, with the CAS number 15379-45-0, is an organic compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features an ethyl group at the 3-position and a diketopiperazine-like structure, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the carbonyl group in the structure suggests potential reactivity, particularly in nucleophilic addition reactions. Additionally, the compound may display interesting biological activities, making it a subject of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure. Overall, 3-ethyl-1,3-dihydro-2H-indol-2-one is a compound of interest for both its chemical properties and potential applications in pharmaceuticals.
Formula:C10H11NO
InChI:InChI=1/C10H11NO/c1-2-7-8-5-3-4-6-9(8)11-10(7)12/h3-7H,2H2,1H3,(H,11,12)
SMILES:CCC1c2ccccc2N=C1O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-ethylindolin-2-one
CAS:<p>3-Ethylindolin-2-one is a synthetic compound that has been shown to be able to alkylate olefins. It is not yet known what the biological function of 3-ethylindolin-2-one might be. It has been found in leaves, but its presence there is not well understood. The reaction of 3-ethylindolin-2-one with amines gives the corresponding amides, while acylation reactions with alcohols yield esters and other compounds. The addition of 3-ethylindolin-2-one to benzene or butyllithium results in the formation of a new ring system containing three carbons and two nitrogens.</p>Formula:C10H11NOPurity:Min. 95%Molecular weight:161.2 g/mol
