CAS 153813-68-4
:2-[2-(Dimethylamino)ethenyl]-9,10-anthracenedione
Description:
2-[2-(Dimethylamino)ethenyl]-9,10-anthracenedione, with the CAS number 153813-68-4, is an organic compound characterized by its anthraquinone structure, which features a conjugated system that contributes to its electronic properties. This compound typically exhibits strong absorption in the ultraviolet-visible (UV-Vis) spectrum due to its extended π-conjugation, making it useful in various applications, including dyes and pigments. The presence of the dimethylamino group enhances its solubility in polar solvents and can influence its reactivity and interaction with biological systems. Additionally, the compound may exhibit fluorescence properties, which are valuable in imaging and sensing applications. Its chemical stability is generally good under standard conditions, although it may be sensitive to light and heat, leading to potential degradation. Overall, this compound's unique structural features and properties make it of interest in fields such as organic electronics, photochemistry, and materials science.
Formula:C18H15NO2
InChI:InChI=1S/C18H15NO2/c1-19(2)10-9-12-7-8-15-16(11-12)18(21)14-6-4-3-5-13(14)17(15)20/h3-11H,1-2H3
InChI key:InChIKey=BRXNFBXZMAJSSI-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC=CC3)=CC(C=CN(C)C)=CC2
Synonyms:- 9,10-Anthracenedione, 2-[2-(dimethylamino)ethenyl]-
- 2-[2-(Dimethylamino)ethenyl]-9,10-anthracenedione
- 2-[(E)-2-(dimethylamino)ethenyl]-9,10-dihydroanthracene-9,10-dione
- 2-[2-(DIMETHYLAMINO)VINYL]ANTHRA-9,10-QUINONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[(E)-2-(Dimethylamino)ethenyl]-9,10-dihydroanthracene-9,10-dione
CAS:2-[(E)-2-(Dimethylamino)ethenyl]-9,10-dihydroanthracene-9,10-dionePurity:techMolecular weight:277.32g/mol
