CAS 15382-78-2
:3-methoxy-4-(8-phenyloctoxy)aniline
Description:
3-Methoxy-4-(8-phenyloctoxy)aniline, with the CAS number 15382-78-2, is an organic compound characterized by its aniline structure, which features an amino group (-NH2) attached to a benzene ring. The presence of a methoxy group (-OCH3) at the 3-position and an octoxy chain with a phenyl substituent at the 4-position contributes to its unique properties. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic octoxy chain, while the methoxy group may enhance its reactivity and influence its electronic properties. The aniline moiety suggests potential applications in dye synthesis, pharmaceuticals, or as an intermediate in organic synthesis. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by the substituents on the aromatic ring, which can affect its interaction with other chemical species. Overall, 3-methoxy-4-(8-phenyloctoxy)aniline represents a versatile compound with potential applications in various fields of chemistry.
Formula:C21H29NO2
InChI:InChI=1/C21H29NO2/c1-23-21-17-19(22)14-15-20(21)24-16-10-5-3-2-4-7-11-18-12-8-6-9-13-18/h6,8-9,12-15,17H,2-5,7,10-11,16,22H2,1H3
Synonyms:- BRN 2816260
- M & B 4863
- m-Anisidine, 4-((8-phenyloctyl)oxy)-
- 3-methoxy-4-[(8-phenyloctyl)oxy]aniline
- 4-((8-Phenyloctyl)oxy)-m-anisidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
m-Anisidine, 4-((8-phenyloctyl)oxy)-
CAS:<p>m-Anisidine, 4-((8-phenyloctyl)oxy)- is a Drug / Therapeutic Agent.</p>Formula:C21H29NO2Color and Shape:SolidMolecular weight:327.46
