CymitQuimica logo

CAS 15382-81-7

:

3-methoxy-4-{[5-(4-methoxyphenyl)pentyl]oxy}aniline

Description:
3-Methoxy-4-{[5-(4-methoxyphenyl)pentyl]oxy}aniline, with the CAS number 15382-81-7, is an organic compound characterized by its complex molecular structure, which includes an aniline core substituted with methoxy and pentyl groups. This compound features a methoxy group (-OCH3) at the 3-position and a phenyl-pentyl ether linkage at the 4-position, contributing to its hydrophobic properties. The presence of the aniline moiety suggests potential applications in dye synthesis or as a precursor in pharmaceuticals. Its molecular structure indicates that it may exhibit moderate solubility in organic solvents while being less soluble in water due to the hydrophobic alkyl chains. Additionally, the methoxy groups can influence the electronic properties of the compound, potentially affecting its reactivity and interaction with biological systems. Overall, this compound's unique structure may lead to interesting chemical behavior and potential applications in various fields, including medicinal chemistry and materials science.
Formula:C19H25NO3
InChI:InChI=1/C19H25NO3/c1-21-17-10-7-15(8-11-17)6-4-3-5-13-23-18-12-9-16(20)14-19(18)22-2/h7-12,14H,3-6,13,20H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.