CymitQuimica logo

CAS 15382-90-8

:

7-(4-amino-2-methoxyphenoxy)-1-phenylheptyl acetate

Description:
7-(4-amino-2-methoxyphenoxy)-1-phenylheptyl acetate, with the CAS number 15382-90-8, is a chemical compound that belongs to the class of organic compounds known as phenyl ethers. This substance features a complex structure characterized by the presence of an acetate group, a heptyl chain, and an amino-substituted phenoxy moiety. Its molecular structure suggests potential biological activity, particularly in pharmacological contexts, due to the presence of the amino group, which can participate in hydrogen bonding and enhance solubility in biological systems. The methoxy group may also contribute to the compound's lipophilicity, affecting its interaction with cellular membranes. Additionally, the phenyl groups in the structure can influence the compound's electronic properties and reactivity. While specific applications or biological activities may vary, compounds of this nature are often investigated for their potential roles in medicinal chemistry, particularly in the development of therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C22H29NO4
InChI:InChI=1/C22H29NO4/c1-17(24)27-20(18-10-6-5-7-11-18)12-8-3-4-9-15-26-21-14-13-19(23)16-22(21)25-2/h5-7,10-11,13-14,16,20H,3-4,8-9,12,15,23H2,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.