CAS 15384-37-9
:D-XYLONO-1,4-LACTONE
Description:
D-Xylono-1,4-lactone is a cyclic ester derived from D-xylonic acid, characterized by its five-membered lactone structure. This compound is typically a white to off-white solid at room temperature and is soluble in water and various organic solvents, reflecting its polar nature due to the presence of hydroxyl groups. D-Xylono-1,4-lactone plays a role in biochemical processes and can be involved in the synthesis of other organic compounds. It is known for its potential applications in the food and pharmaceutical industries, particularly as a building block in the synthesis of carbohydrates and other biologically relevant molecules. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to handle it under controlled conditions. Additionally, its safety profile should be considered, as with any chemical substance, necessitating proper handling and storage practices to mitigate any potential hazards.
Formula:C5H8O5
InChI:InChI=1/C5H8O5/c6-1-2-3(7)4(8)5(9)10-2/h2-4,6-8H,1H2/t2-,3+,4-/m1/s1
InChI key:InChIKey=CUOKHACJLGPRHD-FLRLBIABSA-N
SMILES:C(O)[C@@H]1[C@H](O)[C@@H](O)C(=O)O1
Synonyms:- (3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)dihydrofuran-2(3H)-one (non-preferred name)
- (3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-one
- <span class="text-smallcaps">D</span>-Xylonic acid, γ-lactone
- <span class="text-smallcaps">D</span>-Xylono-1,4-lactone
- <span class="text-smallcaps">D</span>-Xylono-γ-lactone
- D-Xylonic acid, g-lactone (9CI)
- D-xylonic acid gamma-lactone
- Xylonic acid, γ-lactone, <span class="text-smallcaps">D</span>-
- D-Xylono-1,4-lactone
- D-Xylonic acid, γ-lactone
- D-Xylono-γ-lactone
- Xylonic acid, γ-lactone, D-
- (3R,4R,5R)-3,4-Dihydroxy-5-(hydroxymethyl)dihydrofuran-2(3H)-one
- D-Xylonic-1,4-lactone
- D-XYLONO-1,4-LACTONE 1G
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
D-Xylonic acid-1,4-lactone
CAS:Formula:C5H8O5Purity:≥ 97.0%Color and Shape:White to off-white powder to crystalsMolecular weight:148.11D-Xylonic-1,4-lactone
CAS:D-Xylonic acid-1,4-lactone is a substrate that participates in the synthesis of glyceric acid. It has been shown to be a synthetic substrate for benzyl groups and leukemia HL-60 cells. D-Xylonic acid-1,4-lactone can react with chloride ions to form D-xylose. The product of this reaction is an epimerization reaction that occurs when the hydroxyl group on the carbon atom adjacent to the carbonyl group (C1) reacts with a proton from water to form a double bond at C2. This conversion produces xylonic acid and lactone.
Formula:C5H8O5Purity:Min. 97 Area-%Color and Shape:White PowderMolecular weight:148.11 g/molRef: 3D-MX00474
Discontinued product


