CAS 153863-34-4

[1-(4-fluorophenyl)-1H-pyrazol-4-yl]methanol

Description:

[1-(4-fluorophenyl)-1H-pyrazol-4-yl]methanol, with the CAS number 153863-34-4, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the para position, contributing to the compound's unique electronic and steric properties. The methanol functional group (-CH2OH) attached to the pyrazole ring enhances its potential for hydrogen bonding, making it a candidate for various chemical reactions and applications in medicinal chemistry. This compound may exhibit biological activity due to its structural features, which can influence interactions with biological targets. Its solubility, stability, and reactivity can vary depending on the solvent and conditions, making it important for researchers to consider these factors in experimental designs. Overall, [1-(4-fluorophenyl)-1H-pyrazol-4-yl]methanol represents a versatile structure in organic synthesis and pharmaceutical development.

Formula: C₁₀H₉FN₂O

InChI: InChI=1/C10H9FN2O/c11-9-1-3-10(4-2-9)13-6-8(7-14)5-12-13/h1-6,14H,7H2

SMILES: c1cc(ccc1F)n1cc(cn1)CO

Synonyms:

• 1H-pyrazole-4-methanol, 1-(4-fluorophenyl)-

[1-(4-fluorophenyl)-1H-pyrazol-4-yl]methanol

CAS: 153863-34-4

Formula: C₁₀H₉FN₂O

Molecular weight: 192.1897

Ref: IN-DA00ABAJ

[1-(4-Fluorophenyl)-1H-pyrazol-4-yl]methanol

CAS: 153863-34-4

[1-(4-Fluorophenyl)-1H-pyrazol-4-yl]methanol

Purity: 97%

Molecular weight: 192.19g/mol

Ref: 54-PC902881