CAS 1539-06-6
:4-(Acetylamino)-3-nitrobenzoic acid
Description:
4-(Acetylamino)-3-nitrobenzoic acid, with the CAS number 1539-06-6, is an organic compound characterized by its aromatic structure, which includes a nitro group and an acetylamino group attached to a benzoic acid framework. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. It exhibits both acidic and basic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The nitro group contributes to its electron-withdrawing characteristics, influencing its reactivity and stability. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or dyes. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as compounds with nitro groups can be sensitive to reduction and may pose health risks if not managed properly.
Formula:C9H8N2O5
InChI:InChI=1S/C9H8N2O5/c1-5(12)10-7-3-2-6(9(13)14)4-8(7)11(15)16/h2-4H,1H3,(H,10,12)(H,13,14)
InChI key:InChIKey=BRQIMWBIZLRLSV-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(NC(C)=O)C=CC(C(O)=O)=C1
Synonyms:- 3-Nitro-4-acetamidobenzoic acid
- 4-(Acetylamino)-3-Nitrobenzoate
- 4-(Acetylamino)-3-Nitrobenzoic Acid
- Benzoic Acid, 4-(Acetylamino)-3-Nitro-
- Benzoic acid, 4-acetamido-3-nitro-
- NSC 190738
- 4-Acetamido-3-nitrobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Acetamido-3-nitrobenzoic acid
CAS:Formula:C9H8N2O5Purity:98%Color and Shape:SolidMolecular weight:224.17024-Acetamido-3-nitrobenzoic acid
CAS:4-Acetamido-3-nitrobenzoic acidPurity:98%Molecular weight:224.17g/mol4-(Acetylamino)-3-nitrobenzoic acid
CAS:4-(Acetylamino)-3-nitrobenzoic acid (AANBA) is a molecule that inhibits the growth of Mycobacterium tuberculosis and influenza virus. It has been shown to have tuberculostatic activity and is able to adsorb to the cavity of the enzyme protein, preventing access by other molecules. AANBA also has antiviral properties that may be due to its ability to inhibit viral particles from binding with a cell surface receptor or inhibiting the synthesis of viral proteins. AANBA binds to the chloride ion in order to maintain the negative charge of the molecule, which is crucial for its antiviral activity.
Formula:C9H8N2O5Purity:Min. 95%Color and Shape:Slightly Yellow PowderMolecular weight:224.17 g/mol




