CAS 15396-38-0
:2,3,5-Tribromobenzoic acid
Description:
2,3,5-Tribromobenzoic acid is an aromatic carboxylic acid characterized by the presence of three bromine substituents on the benzene ring, specifically at the 2, 3, and 5 positions relative to the carboxylic acid group. This compound typically appears as a white to off-white solid and is known for its relatively low solubility in water, while being more soluble in organic solvents. The presence of bromine atoms enhances its reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. The carboxylic acid functional group imparts acidic properties, allowing it to participate in acid-base reactions. Additionally, 2,3,5-Tribromobenzoic acid may exhibit biological activity, which can be of interest in medicinal chemistry. Safety data should be consulted, as brominated compounds can pose environmental and health risks. Overall, this compound is significant in both industrial and research contexts due to its unique structural features and reactivity.
Formula:C7H3Br3O2
InChI:InChI=1S/C7H3Br3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12)
InChI key:InChIKey=VXRZWSOTDBLHDQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C(Br)=CC(Br)=C1
Synonyms:- Benzoic acid, 2,3,5-tribromo-
- 2,3,5-Tribromobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


