CAS 15397-25-8

4-(beta-D-glucopyranosyloxy)benzoic acid

Description:

4-(Beta-D-glucopyranosyloxy)benzoic acid, with the CAS number 15397-25-8, is a chemical compound characterized by the presence of a benzoic acid moiety linked to a beta-D-glucopyranosyl group through an ether bond. This compound exhibits both hydrophilic and hydrophobic properties due to its sugar and aromatic components, making it potentially useful in various applications, including pharmaceuticals and food science. The glucopyranosyl group enhances its solubility in water, while the benzoic acid part contributes to its ability to interact with biological systems. It may exhibit biological activities such as antioxidant properties or serve as a precursor in the synthesis of more complex molecules. The compound's structure allows for hydrogen bonding, which can influence its reactivity and interactions with other substances. Overall, 4-(beta-D-glucopyranosyloxy)benzoic acid is of interest for its potential applications in medicinal chemistry and as a functional ingredient in various formulations.

Formula: C₁₃H₁₆O₈

InChI: InChI=1/C13H16O8/c14-5-8-9(15)10(16)11(17)13(21-8)20-7-3-1-6(2-4-7)12(18)19/h1-4,8-11,13-17H,5H2,(H,18,19)/t8-,9-,10+,11-,13-/m1/s1

Synonyms:

• benzoic acid, 4-(beta-D-glucopyranosyloxy)-
• Gastrodin Impurity 14
• Benzoic acid, 4-(β-D-glucopyranosyloxy)-

4-(β-D-glucopyranosyloxy)benzoic acid

CAS: 15397-25-8

4-(β-D-glucopyranosyloxy)benzoic acid is a naturally occurring phenolic glucoside that can be used for related research in the life sciences.

Formula: C₁₃H₁₆O₈

Purity: 99.64%

Color and Shape: Solid

Molecular weight: 300.26

Ref: TM-T83333

4-(β-D-glucopyranosyloxy)benzoic acid

CAS: 15397-25-8

4-(β-D-glucopyranosyloxy)benzoic acid

Purity: ≥98%

Molecular weight: 300.26g/mol

Ref: 54-BUP21183

Gastrodin Impurity 2

CAS: 15397-25-8

Formula: C₁₃H₁₆O₈

Molecular weight: 300.26

Ref: 4Z-G-054003