CAS 154-07-4
:5-Chloro-DL-tryptophan
Description:
5-Chloro-DL-tryptophan is an amino acid derivative and a halogenated form of tryptophan, characterized by the presence of a chlorine atom at the 5-position of the indole ring. This compound is a white to off-white crystalline solid that is soluble in water and polar organic solvents. It exhibits properties typical of amino acids, including the ability to participate in peptide bond formation and act as a building block for proteins. The presence of the chlorine atom can influence its biochemical behavior, potentially affecting its interactions with enzymes and receptors. 5-Chloro-DL-tryptophan is often used in biochemical research, particularly in studies related to neurotransmitter synthesis and metabolism, as tryptophan is a precursor to serotonin. Additionally, it may serve as a tool in the study of protein structure and function due to its unique side chain properties. Safety data indicates that, like many chemical substances, it should be handled with care, following appropriate safety protocols to minimize exposure and environmental impact.
Formula:C11H11ClN2O2
InChI:InChI=1/C11H11ClN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m0/s1
SMILES:c1cc2c(cc1Cl)c(C[C@@H](C(=O)O)N)c[nH]2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Chloro-DL-tryptophan
CAS:Formula:C11H11ClN2O2Purity:97%Color and Shape:SolidMolecular weight:238.67025-Chloro-DL-tryptophan
CAS:Controlled ProductFormula:C11H11ClN2O2Color and Shape:NeatMolecular weight:238.675-Chloro-DL-tryptophan
CAS:5-Chloro-DL-tryptophan is an antibiotic that is synthesized from tryptophan. It is used as a precursor for the synthesis of other antibiotics, including 5-chloro-dl-tryptophan and indole. 5-Chloro-DL-tryptophan has been shown to have a significant effect on the synthesis of protein amino acids, such as d-aspartic acid and α-amino acids. The steric properties of 5-chloro-dl-tryptophan are also important in its ability to block protein synthesis. Ozonization can be used to oxidize α,β unsaturated carbonyl compounds found in 5 - chloro - DL - tryptophan.
Formula:C11H11ClN2O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:238.67 g/mol5-Chloro-DL-tryptophan
CAS:5-Chloro-DL-tryptophan is a research chemical that is used as a building block in the synthesis of other chemicals.
Formula:C11H11ClN2O2Molecular weight:238.68 g/mol5-Chloro-DL-tryptophan
CAS:Formula:C11H11ClN2O2Purity:97.0%Color and Shape:SolidMolecular weight:238.67




