CAS 154-36-9
:Trifoside
Description:
Trifoside, with the CAS number 154-36-9, is a chemical compound that belongs to the class of phosphonic acids. It is characterized by the presence of three phosphonic acid groups, which contribute to its unique chemical properties. Trifoside is typically a white crystalline solid that is soluble in water, making it useful in various applications, particularly in agriculture as a plant growth regulator and in the synthesis of other chemical compounds. The presence of multiple phosphonic acid groups allows trifoside to interact effectively with biological systems, influencing metabolic pathways and enhancing nutrient uptake in plants. Additionally, its chemical structure enables it to act as a chelating agent, binding to metal ions and potentially improving the bioavailability of nutrients. Safety data indicates that, like many phosphonic compounds, trifoside should be handled with care, as it may pose environmental risks if not managed properly. Overall, trifoside's unique properties make it a valuable compound in both industrial and agricultural contexts.
Formula:C22H22O10
InChI:InChI=1S/C22H22O10/c1-29-12-6-14(24)17-15(7-12)30-9-13(18(17)25)10-2-4-11(5-3-10)31-22-21(28)20(27)19(26)16(8-23)32-22/h2-7,9,16,19-24,26-28H,8H2,1H3/t16-,19-,20+,21-,22-/m1/s1
InChI key:InChIKey=OFUWGCQDMVDLIR-RECXWPGBSA-N
SMILES:O=C1C=2C(OC=C1C3=CC=C(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)C=C3)=CC(OC)=CC2O
Synonyms:- 3-[4-(β-<span class="text-smallcaps">D</span>-Glucopyranosyloxy)phenyl]-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3-[4-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)phenyl]-5-hydroxy-7-methoxy-
- Prunetin 4'-O-b-D-glucopyranoside
- Prunetin 4'-O-b-D-glucoside
- Prunetin 4′-O-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Prunetin 4′-O-β-<span class="text-smallcaps">D</span>-glucoside
- Prunetrin
- Prunitrin
- Prunitrin(6CI,8CI)
- Trifoside
- 4H-1-Benzopyran-4-one, 3-[4-(β-D-glucopyranosyloxy)phenyl]-5-hydroxy-7-methoxy-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Prunetin-4'-O-glucoside
CAS:Prunetin-4'-O-glucoside analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C22H22O10Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:446.41Prunetrin
CAS:Prunetrin (Trifoside) is a natural flavonoid that activates 5'UTR-driven α-Synuclein mRNA translation (EC50=250 nM).Formula:C22H22O10Color and Shape:SolidMolecular weight:446.45-Hydroxy-7-methoxy-3-(4-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)phenyl)-4H-chromen-4-one
CAS:5-Hydroxy-7-methoxy-3-(4-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)phenyl)-4H-chromen-4-onePurity:98%Molecular weight:446.41g/molPrunetin-4'-glucoside
CAS:Prunetin-4'-glucoside is a specialized flavonoid compound, categorized as a glucoside, which is derived from natural plant sources. This glycosylated form of prunetin is found in various plants and serves as part of the plant's defense mechanism. Its mode of action involves antioxidative properties that neutralize free radicals, thus protecting cellular structures from oxidative damage. This mechanism is crucial as oxidative stress is implicated in numerous diseases.
Formula:C22H22O10Purity:Min. 95%Molecular weight:446.4 g/mol





